2-Amino-3-hydroxy-4-bromopyridine hydrobromide

2-Amino-3-hydroxy-4-bromopyridine hydrobromide - Names and Identifiers

Name	2-Amino-3-hydroxy-4-bromopyridine HBr
Synonyms	2-AMino-3-hydroxy-4-broMopydine HBr 2-Amino-4-bromo-3-hydroxypyridine HBr 2-Amino-3-hydroxy-4-bromopyridine HBr 2-AMINO-3-HYDROXY-4-BROMOPYRIDINE HBR 2-Amino-4-bromo-3-hydroxypyridine hbr 2-amino-4-bromohydroxopyridinum bromide 2-AMino-4-broMopyridin-3-ol hydrobroMide 2-amino-4-bromo-3-pyridinol hydrobromide 2-Amino-4-bromo-3-pyridinol monohydrobromide 2-Amino-3-hydroxy-4-bromopyridine hydrobromide 2-AMINO-3-HYDROXY-4-BROMOPYRIDINE HYDROBROMIDE
CAS	114414-17-4
InChI	InChI=1/C5H5BrN2O.BrH/c6-3-1-2-8-5(7)4(3)9;/h1-2,9H,(H2,7,8);1H

2-Amino-3-hydroxy-4-bromopyridine hydrobromide - Physico-chemical Properties

Molecular Formula	C5H6Br2N2O
Molar Mass	269.92194
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C

2-Amino-3-hydroxy-4-bromopyridine hydrobromide - Introduction

2-amino -3-hydroxy -4-bromopyridine hydrogen bromide, chemical formula is C5H5Br2N2O.

Nature:
1. Appearance: White crystalline solid.
2. melting point: about 165 ℃.
3. stability: sensitive to light and air, should be stored in the dark, dry, sealed conditions.

Use:
1. 2-Amino-3-hydroxy-4-bromopyridine hydrogen bromide is an important pharmaceutical intermediate, which is widely used in organic synthesis and pharmaceutical industry.
2. it can be used for the synthesis of lodilol, ezonapril and other drugs.

Method:
2-amino -3-hydroxy -4-bromine pyridine hydrogen bromide preparation method is more, the following is a commonly used preparation method:
2-amino -3-bromopyridine is generated by reacting 2-bromopyridine with ammonium hydroxide, and then 2-amino -3-hydroxy -4-bromopyridine is obtained by alternately treating with sodium hydroxide and potassium hydroxide. Finally, 2-amino-3-hydroxy-4-bromopyridine hydrogen bromide is obtained by reaction with hydrochloric acid.

Safety Information:
1. 2-Amino-3-hydroxy-4-bromopyridine hydrogen bromide has certain irritation and corrosiveness to eyes. It is necessary to prevent contact with skin and eyes when using it.
2. Wear appropriate personal protective equipment such as lab gloves and goggles during operation.
3. in the process of storage and handling to avoid high temperature, fire and open flame.

Last Update：2024-04-09 21:00:56